C10H10O — CID 139246436
9-oxatetracyclo[5.3.1.01,7.04,11]undeca-2,5-diene (PubChem CID 139246436) has the molecular formula C10H10O and a molecular weight of 146.19 g/mol. Its IUPAC name is 9-oxatetracyclo[5.3.1.01,7.04,11]undeca-2,5-diene.
| Compound Name | 9-oxatetracyclo[5.3.1.01,7.04,11]undeca-2,5-diene |
|---|---|
| PubChem CID | 139246436 |
| Molecular Formula | C10H10O |
| Molecular Weight | 146.19 g/mol |
| Exact Mass | 146.07 |
| IUPAC Name | 9-oxatetracyclo[5.3.1.01,7.04,11]undeca-2,5-diene |
| SMILES | C1=CC23COCC24C=CC1C34 |
| InChI | InChI=1S/C10H10O/c1-3-9-5-11-6-10(9)4-2-7(1)8(9)10/h1-4,7-8H,5-6H2 |
| InChIKey | GZOQKUGJGGQWCR-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.19 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|