About 9-oxatetracyclo[5.3.1.01,7.04,11]undeca-2,5-diene
9-oxatetracyclo[5.3.1.01,7.04,11]undeca-2,5-diene (PubChem CID 139246436) has the molecular formula C10H10O
and a molecular weight of 146.19 g/mol. Its IUPAC name is 9-oxatetracyclo[5.3.1.01,7.04,11]undeca-2,5-diene.
Molecular Properties
| Compound Name | 9-oxatetracyclo[5.3.1.01,7.04,11]undeca-2,5-diene |
| PubChem CID | 139246436 |
| Molecular Formula | C10H10O |
| Molecular Weight | 146.19 g/mol |
| Exact Mass | 146.07 |
| IUPAC Name | 9-oxatetracyclo[5.3.1.01,7.04,11]undeca-2,5-diene |
| SMILES | C1=CC23COCC24C=CC1C34 |
| InChI | InChI=1S/C10H10O/c1-3-9-5-11-6-10(9)4-2-7(1)8(9)10/h1-4,7-8H,5-6H2 |
| InChIKey | GZOQKUGJGGQWCR-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.19 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 9-oxatetracyclo[5.3.1.01,7.04,11]undeca-2,5-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-oxatetracyclo[5.3.1.01,7.04,11]undeca-2,5-diene?
The IUPAC name of 9-oxatetracyclo[5.3.1.01,7.04,11]undeca-2,5-diene (CID 139246436) is 9-oxatetracyclo[5.3.1.01,7.04,11]undeca-2,5-diene.
What is the SMILES notation for 9-oxatetracyclo[5.3.1.01,7.04,11]undeca-2,5-diene?
The canonical SMILES for 9-oxatetracyclo[5.3.1.01,7.04,11]undeca-2,5-diene is C1=CC23COCC24C=CC1C34.
What is the InChIKey of 9-oxatetracyclo[5.3.1.01,7.04,11]undeca-2,5-diene?
The InChIKey is GZOQKUGJGGQWCR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10O/c1-3-9-5-11-6-10(9)4-2-7(1)8(9)10/h1-4,7-8H,5-6H2.
What are the key properties of 9-oxatetracyclo[5.3.1.01,7.04,11]undeca-2,5-diene?
9-oxatetracyclo[5.3.1.01,7.04,11]undeca-2,5-diene has a molecular weight of 146.19 g/mol, XLogP of 1.38, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 9-oxatetracyclo[5.3.1.01,7.04,11]undeca-2,5-diene is sourced from PubChem (CID 139246436), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).