C36H37N3O5 — CID 139246609
methyl (1R,3S)-2-[(2S)-1-(9H-fluoren-9-ylmethoxycarbonyl)pyrrolidine-2-carbonyl]-1-propan-2-yl-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylate (PubChem CID 139246609) has the molecular formula C36H37N3O5 and a molecular weight of 591.71 g/mol. Its IUPAC name is methyl (1R,3S)-2-[(2S)-1-(9H-fluoren-9-ylmethoxycarbonyl)pyrrolidine-2-carbonyl]-1-propan-2-yl-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylate.
| Compound Name | methyl (1R,3S)-2-[(2S)-1-(9H-fluoren-9-ylmethoxycarbonyl)pyrrolidine-2-carbonyl]-1-propan-2-yl-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylate |
|---|---|
| PubChem CID | 139246609 |
| Molecular Formula | C36H37N3O5 |
| Molecular Weight | 591.71 g/mol |
| Exact Mass | 591.27 |
| IUPAC Name | methyl (1R,3S)-2-[(2S)-1-(9H-fluoren-9-ylmethoxycarbonyl)pyrrolidine-2-carbonyl]-1-propan-2-yl-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylate |
| SMILES | COC(=O)[C@@H]1Cc2c([nH]c3ccccc23)[C@@H](C(C)C)N1C(=O)[C@@H]1CCCN1C(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C36H37N3O5/c1-21(2)33-32-27(26-15-8-9-16-29(26)37-32)19-31(35(41)43-3)39(33)34(40)30-17-10-18-38(30)36(42)44-20-28-24-13-6-4-11-22(24)23-12-5-7-14-25(23)28/h4-9,11-16,21,28,30-31,33,37H,10,17-20H2,1-3H3/t30-,31-,33+/m0/s1 |
| InChIKey | WJHHEKDQKODDQU-MZSJJGOWSA-N |
| XLogP | 6.20 |
| TPSA | 91.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.71 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|