C13H22O4 — CID 139246944
(2R,3S)-2-octyl-5-oxooxolane-3-carboxylic acid (PubChem CID 139246944) has the molecular formula C13H22O4 and a molecular weight of 242.31 g/mol. Its IUPAC name is (2R,3S)-2-octyl-5-oxooxolane-3-carboxylic acid.
| Compound Name | (2R,3S)-2-octyl-5-oxooxolane-3-carboxylic acid |
|---|---|
| PubChem CID | 139246944 |
| Molecular Formula | C13H22O4 |
| Molecular Weight | 242.31 g/mol |
| Exact Mass | 242.15 |
| IUPAC Name | (2R,3S)-2-octyl-5-oxooxolane-3-carboxylic acid |
| SMILES | CCCCCCCC[C@H]1OC(=O)C[C@@H]1C(=O)O |
| InChI | InChI=1S/C13H22O4/c1-2-3-4-5-6-7-8-11-10(13(15)16)9-12(14)17-11/h10-11H,2-9H2,1H3,(H,15,16)/t10-,11+/m0/s1 |
| InChIKey | AHPUKXWCGJZWMG-WDEREUQCSA-N |
| XLogP | 2.75 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.31 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|