C38H36N2Pt — CID 139246985
5-[3-(10,10-dimethyl-4-azatricyclo[7.1.1.02,7]undeca-2,4,6-trien-5-yl)benzene-2-id-1-yl]-10,10-dimethyl-4-azatricyclo[7.1.1.02,7]undeca-2,4,6-triene;ethynylbenzene;platinum(2+) (PubChem CID 139246985) has the molecular formula C38H36N2Pt and a molecular weight of 715.80 g/mol. Its IUPAC name is 5-[3-(10,10-dimethyl-4-azatricyclo[7.1.1.02,7]undeca-2,4,6-trien-5-yl)benzene-2-id-1-yl]-10,10-dimethyl-4-azatricyclo[7.1.1.02,7]undeca-2,4,6-triene;ethynylbenzene;platinum(2+).
| Compound Name | 5-[3-(10,10-dimethyl-4-azatricyclo[7.1.1.02,7]undeca-2,4,6-trien-5-yl)benzene-2-id-1-yl]-10,10-dimethyl-4-azatricyclo[7.1.1.02,7]undeca-2,4,6-triene;ethynylbenzene;platinum(2+) |
|---|---|
| PubChem CID | 139246985 |
| Molecular Formula | C38H36N2Pt |
| Molecular Weight | 715.80 g/mol |
| Exact Mass | 715.25 |
| IUPAC Name | 5-[3-(10,10-dimethyl-4-azatricyclo[7.1.1.02,7]undeca-2,4,6-trien-5-yl)benzene-2-id-1-yl]-10,10-dimethyl-4-azatricyclo[7.1.1.02,7]undeca-2,4,6-triene;ethynylbenzene;platinum(2+) |
| SMILES | CC1(C)C2Cc3cc(-c4[c-]c(-c5cc6c(cn5)C5CC(C6)C5(C)C)ccc4)ncc3C1C2.[C-]#Cc1ccccc1.[Pt+2] |
| InChI | InChI=1S/C30H31N2.C8H5.Pt/c1-29(2)21-9-19-11-27(31-15-23(19)25(29)13-21)17-6-5-7-18(8-17)28-12-20-10-22-14-26(30(22,3)4)24(20)16-32-28;1-2-8-6-4-3-5-7-8;/h5-7,11-12,15-16,21-22,25-26H,9-10,13-14H2,1-4H3;3-7H;/q2*-1;+2 |
| InChIKey | LVBHTOMRUBOFAP-UHFFFAOYSA-N |
| XLogP | 8.60 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 715.80 |
| LogP ≤ 5 | 8.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|