C23H31NO4 — CID 139247221
benzyl N-[(3S,4R)-3-hydroxy-2,5-dimethyl-4-phenylmethoxyhexan-2-yl]carbamate (PubChem CID 139247221) has the molecular formula C23H31NO4 and a molecular weight of 385.50 g/mol. Its IUPAC name is benzyl N-[(3S,4R)-3-hydroxy-2,5-dimethyl-4-phenylmethoxyhexan-2-yl]carbamate.
| Compound Name | benzyl N-[(3S,4R)-3-hydroxy-2,5-dimethyl-4-phenylmethoxyhexan-2-yl]carbamate |
|---|---|
| PubChem CID | 139247221 |
| Molecular Formula | C23H31NO4 |
| Molecular Weight | 385.50 g/mol |
| Exact Mass | 385.23 |
| IUPAC Name | benzyl N-[(3S,4R)-3-hydroxy-2,5-dimethyl-4-phenylmethoxyhexan-2-yl]carbamate |
| SMILES | CC(C)[C@@H](OCc1ccccc1)[C@@H](O)C(C)(C)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C23H31NO4/c1-17(2)20(27-15-18-11-7-5-8-12-18)21(25)23(3,4)24-22(26)28-16-19-13-9-6-10-14-19/h5-14,17,20-21,25H,15-16H2,1-4H3,(H,24,26)/t20-,21-/m1/s1 |
| InChIKey | YMCDYXNAAPSMQL-NHCUHLMSSA-N |
| XLogP | 4.29 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.50 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |