About 1-[(1R,2S)-2-dimethoxyphosphoryl-2-phenylcyclopropyl]-4-methylbenzene
1-[(1R,2S)-2-dimethoxyphosphoryl-2-phenylcyclopropyl]-4-methylbenzene (PubChem CID 139247384) has the molecular formula C18H21O3P
and a molecular weight of 316.34 g/mol. Its IUPAC name is 1-[(1R,2S)-2-dimethoxyphosphoryl-2-phenylcyclopropyl]-4-methylbenzene.
Molecular Properties
| Compound Name | 1-[(1R,2S)-2-dimethoxyphosphoryl-2-phenylcyclopropyl]-4-methylbenzene |
| PubChem CID | 139247384 |
| Molecular Formula | C18H21O3P |
| Molecular Weight | 316.34 g/mol |
| Exact Mass | 316.12 |
| IUPAC Name | 1-[(1R,2S)-2-dimethoxyphosphoryl-2-phenylcyclopropyl]-4-methylbenzene |
| SMILES | COP(=O)(OC)[C@@]1(c2ccccc2)C[C@@H]1c1ccc(C)cc1 |
| InChI | InChI=1S/C18H21O3P/c1-14-9-11-15(12-10-14)17-13-18(17,22(19,20-2)21-3)16-7-5-4-6-8-16/h4-12,17H,13H2,1-3H3/t17-,18-/m1/s1 |
| InChIKey | BPMSJUACLDOLOP-QZTJIDSGSA-N |
| XLogP | 4.86 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.34 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 1-[(1R,2S)-2-dimethoxyphosphoryl-2-phenylcyclopropyl]-4-methylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(1R,2S)-2-dimethoxyphosphoryl-2-phenylcyclopropyl]-4-methylbenzene?
The IUPAC name of 1-[(1R,2S)-2-dimethoxyphosphoryl-2-phenylcyclopropyl]-4-methylbenzene (CID 139247384) is 1-[(1R,2S)-2-dimethoxyphosphoryl-2-phenylcyclopropyl]-4-methylbenzene.
What is the SMILES notation for 1-[(1R,2S)-2-dimethoxyphosphoryl-2-phenylcyclopropyl]-4-methylbenzene?
The canonical SMILES for 1-[(1R,2S)-2-dimethoxyphosphoryl-2-phenylcyclopropyl]-4-methylbenzene is COP(=O)(OC)[C@@]1(c2ccccc2)C[C@@H]1c1ccc(C)cc1.
What is the InChIKey of 1-[(1R,2S)-2-dimethoxyphosphoryl-2-phenylcyclopropyl]-4-methylbenzene?
The InChIKey is BPMSJUACLDOLOP-QZTJIDSGSA-N. The full InChI is InChI=1S/C18H21O3P/c1-14-9-11-15(12-10-14)17-13-18(17,22(19,20-2)21-3)16-7-5-4-6-8-16/h4-12,17H,13H2,1-3H3/t17-,18-/m1/s1.
What are the key properties of 1-[(1R,2S)-2-dimethoxyphosphoryl-2-phenylcyclopropyl]-4-methylbenzene?
1-[(1R,2S)-2-dimethoxyphosphoryl-2-phenylcyclopropyl]-4-methylbenzene has a molecular weight of 316.34 g/mol, XLogP of 4.86, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(1R,2S)-2-dimethoxyphosphoryl-2-phenylcyclopropyl]-4-methylbenzene is sourced from PubChem (CID 139247384), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).