C19H22N2O2 — CID 139247817
(R)-[(2S)-7-ethenyl-1-azabicyclo[2.2.1]heptan-2-yl]-(6-methoxyquinolin-4-yl)methanol (PubChem CID 139247817) has the molecular formula C19H22N2O2 and a molecular weight of 310.40 g/mol. Its IUPAC name is (R)-[(2S)-7-ethenyl-1-azabicyclo[2.2.1]heptan-2-yl]-(6-methoxyquinolin-4-yl)methanol.
| Compound Name | (R)-[(2S)-7-ethenyl-1-azabicyclo[2.2.1]heptan-2-yl]-(6-methoxyquinolin-4-yl)methanol |
|---|---|
| PubChem CID | 139247817 |
| Molecular Formula | C19H22N2O2 |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.17 |
| IUPAC Name | (R)-[(2S)-7-ethenyl-1-azabicyclo[2.2.1]heptan-2-yl]-(6-methoxyquinolin-4-yl)methanol |
| SMILES | C=CC1C2CCN1[C@H]([C@H](O)c1ccnc3ccc(OC)cc13)C2 |
| InChI | InChI=1S/C19H22N2O2/c1-3-17-12-7-9-21(17)18(10-12)19(22)14-6-8-20-16-5-4-13(23-2)11-15(14)16/h3-6,8,11-12,17-19,22H,1,7,9-10H2,2H3/t12?,17?,18-,19+/m0/s1 |
| InChIKey | HMEFLRXJMBARSY-DKJHAFTISA-N |
| XLogP | 2.93 |
| TPSA | 45.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|