C18H32O5 — CID 139248072
(3S,4S)-4-hydroxy-3-methoxycarbonyl-2-methylidenepentadecanoic acid (PubChem CID 139248072) has the molecular formula C18H32O5 and a molecular weight of 328.45 g/mol. Its IUPAC name is (3S,4S)-4-hydroxy-3-methoxycarbonyl-2-methylidenepentadecanoic acid.
| Compound Name | (3S,4S)-4-hydroxy-3-methoxycarbonyl-2-methylidenepentadecanoic acid |
|---|---|
| PubChem CID | 139248072 |
| Molecular Formula | C18H32O5 |
| Molecular Weight | 328.45 g/mol |
| Exact Mass | 328.22 |
| IUPAC Name | (3S,4S)-4-hydroxy-3-methoxycarbonyl-2-methylidenepentadecanoic acid |
| SMILES | C=C(C(=O)O)[C@H](C(=O)OC)[C@@H](O)CCCCCCCCCCC |
| InChI | InChI=1S/C18H32O5/c1-4-5-6-7-8-9-10-11-12-13-15(19)16(18(22)23-3)14(2)17(20)21/h15-16,19H,2,4-13H2,1,3H3,(H,20,21)/t15-,16-/m0/s1 |
| InChIKey | NPYSTRNJQZUVPT-HOTGVXAUSA-N |
| XLogP | 3.70 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.45 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|