C33H47N5O13Si — CID 139248210
[(2S,3S,4R)-3,4-diacetyloxy-1-(7,8-dimethyl-2,4-dioxobenzo[g]pteridin-10-yl)-5-(3-triethoxysilylpropylcarbamoyloxy)pentan-2-yl] acetate (PubChem CID 139248210) has the molecular formula C33H47N5O13Si and a molecular weight of 749.85 g/mol. Its IUPAC name is [(2S,3S,4R)-3,4-diacetyloxy-1-(7,8-dimethyl-2,4-dioxobenzo[g]pteridin-10-yl)-5-(3-triethoxysilylpropylcarbamoyloxy)pentan-2-yl] acetate.
| Compound Name | [(2S,3S,4R)-3,4-diacetyloxy-1-(7,8-dimethyl-2,4-dioxobenzo[g]pteridin-10-yl)-5-(3-triethoxysilylpropylcarbamoyloxy)pentan-2-yl] acetate |
|---|---|
| PubChem CID | 139248210 |
| Molecular Formula | C33H47N5O13Si |
| Molecular Weight | 749.85 g/mol |
| Exact Mass | 749.29 |
| IUPAC Name | [(2S,3S,4R)-3,4-diacetyloxy-1-(7,8-dimethyl-2,4-dioxobenzo[g]pteridin-10-yl)-5-(3-triethoxysilylpropylcarbamoyloxy)pentan-2-yl] acetate |
| SMILES | CCO[Si](CCCNC(=O)OC[C@@H](OC(C)=O)[C@@H](OC(C)=O)[C@H](Cn1c2nc(=O)[nH]c(=O)c-2nc2cc(C)c(C)cc21)OC(C)=O)(OCC)OCC |
| InChI | InChI=1S/C33H47N5O13Si/c1-9-46-52(47-10-2,48-11-3)14-12-13-34-33(44)45-18-27(50-22(7)40)29(51-23(8)41)26(49-21(6)39)17-38-25-16-20(5)19(4)15-24(25)35-28-30(38)36-32(43)37-31(28)42/h15-16,26-27,29H,9-14,17-18H2,1-8H3,(H,34,44)(H,37,42,43)/t26-,27+,29-/m0/s1 |
| InChIKey | VPXBDYSZHFRVCY-GKRYNVPLSA-N |
| XLogP | 2.16 |
| TPSA | 225.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 749.85 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|