C21H30F6O4 — CID 139248231
bis(2,2,2-trifluoroethyl) 2,2-bis[(Z)-5-methylhex-3-enyl]propanedioate (PubChem CID 139248231) has the molecular formula C21H30F6O4 and a molecular weight of 460.46 g/mol. Its IUPAC name is bis(2,2,2-trifluoroethyl) 2,2-bis[(Z)-5-methylhex-3-enyl]propanedioate.
| Compound Name | bis(2,2,2-trifluoroethyl) 2,2-bis[(Z)-5-methylhex-3-enyl]propanedioate |
|---|---|
| PubChem CID | 139248231 |
| Molecular Formula | C21H30F6O4 |
| Molecular Weight | 460.46 g/mol |
| Exact Mass | 460.20 |
| IUPAC Name | bis(2,2,2-trifluoroethyl) 2,2-bis[(Z)-5-methylhex-3-enyl]propanedioate |
| SMILES | CC(C)/C=C\CCC(CC/C=C\C(C)C)(C(=O)OCC(F)(F)F)C(=O)OCC(F)(F)F |
| InChI | InChI=1S/C21H30F6O4/c1-15(2)9-5-7-11-19(12-8-6-10-16(3)4,17(28)30-13-20(22,23)24)18(29)31-14-21(25,26)27/h5-6,9-10,15-16H,7-8,11-14H2,1-4H3/b9-5-,10-6- |
| InChIKey | FTGSGWFFAHZZOD-OZDSWYPASA-N |
| XLogP | 6.17 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.46 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|