C12H22O5 — CID 139248478
tert-butyl (2R,3R)-2,3-dihydroxy-3-[(2S,3S)-3-propyloxiran-2-yl]propanoate (PubChem CID 139248478) has the molecular formula C12H22O5 and a molecular weight of 246.30 g/mol. Its IUPAC name is tert-butyl (2R,3R)-2,3-dihydroxy-3-[(2S,3S)-3-propyloxiran-2-yl]propanoate.
| Compound Name | tert-butyl (2R,3R)-2,3-dihydroxy-3-[(2S,3S)-3-propyloxiran-2-yl]propanoate |
|---|---|
| PubChem CID | 139248478 |
| Molecular Formula | C12H22O5 |
| Molecular Weight | 246.30 g/mol |
| Exact Mass | 246.15 |
| IUPAC Name | tert-butyl (2R,3R)-2,3-dihydroxy-3-[(2S,3S)-3-propyloxiran-2-yl]propanoate |
| SMILES | CCC[C@@H]1O[C@H]1[C@H](O)[C@@H](O)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C12H22O5/c1-5-6-7-10(16-7)8(13)9(14)11(15)17-12(2,3)4/h7-10,13-14H,5-6H2,1-4H3/t7-,8+,9+,10+/m0/s1 |
| InChIKey | WMQUDOKXFPPRJZ-SGIHWFKDSA-N |
| XLogP | 0.62 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.30 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|