C13H22O5 — CID 139248482
ethyl (2S,3S)-3-[(2S,3S)-3-cyclohexyloxiran-2-yl]-2,3-dihydroxypropanoate (PubChem CID 139248482) has the molecular formula C13H22O5 and a molecular weight of 258.31 g/mol. Its IUPAC name is ethyl (2S,3S)-3-[(2S,3S)-3-cyclohexyloxiran-2-yl]-2,3-dihydroxypropanoate.
| Compound Name | ethyl (2S,3S)-3-[(2S,3S)-3-cyclohexyloxiran-2-yl]-2,3-dihydroxypropanoate |
|---|---|
| PubChem CID | 139248482 |
| Molecular Formula | C13H22O5 |
| Molecular Weight | 258.31 g/mol |
| Exact Mass | 258.15 |
| IUPAC Name | ethyl (2S,3S)-3-[(2S,3S)-3-cyclohexyloxiran-2-yl]-2,3-dihydroxypropanoate |
| SMILES | CCOC(=O)[C@@H](O)[C@H](O)[C@@H]1O[C@H]1C1CCCCC1 |
| InChI | InChI=1S/C13H22O5/c1-2-17-13(16)10(15)9(14)12-11(18-12)8-6-4-3-5-7-8/h8-12,14-15H,2-7H2,1H3/t9-,10-,11-,12-/m0/s1 |
| InChIKey | LXCJAJWEPDYDLM-BJDJZHNGSA-N |
| XLogP | 0.62 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.31 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|