C31H25N7O6 — CID 139248653
ethyl 1,6-bis(4-nitrophenyl)-3,8-diphenyl-5,8a-dihydro-[1,2,4]triazolo[4,3-d][1,2,4]triazine-5-carboxylate (PubChem CID 139248653) has the molecular formula C31H25N7O6 and a molecular weight of 591.58 g/mol. Its IUPAC name is ethyl 1,6-bis(4-nitrophenyl)-3,8-diphenyl-5,8a-dihydro-[1,2,4]triazolo[4,3-d][1,2,4]triazine-5-carboxylate.
| Compound Name | ethyl 1,6-bis(4-nitrophenyl)-3,8-diphenyl-5,8a-dihydro-[1,2,4]triazolo[4,3-d][1,2,4]triazine-5-carboxylate |
|---|---|
| PubChem CID | 139248653 |
| Molecular Formula | C31H25N7O6 |
| Molecular Weight | 591.58 g/mol |
| Exact Mass | 591.19 |
| IUPAC Name | ethyl 1,6-bis(4-nitrophenyl)-3,8-diphenyl-5,8a-dihydro-[1,2,4]triazolo[4,3-d][1,2,4]triazine-5-carboxylate |
| SMILES | CCOC(=O)C1N(c2ccc([N+](=O)[O-])cc2)N=C(c2ccccc2)C2N(c3ccc([N+](=O)[O-])cc3)N=C(c3ccccc3)N12 |
| InChI | InChI=1S/C31H25N7O6/c1-2-44-31(39)30-34-28(22-11-7-4-8-12-22)33-35(23-13-17-25(18-14-23)37(40)41)29(34)27(21-9-5-3-6-10-21)32-36(30)24-15-19-26(20-16-24)38(42)43/h3-20,29-30H,2H2,1H3 |
| InChIKey | PLTFOUNRIXVGCA-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 147.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.58 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|