C39H60B2O10 — CID 139249373
2-[9,9-bis[2-[2-(2-methoxyethoxy)ethoxy]ethyl]-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)fluoren-1-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 139249373) has the molecular formula C39H60B2O10 and a molecular weight of 710.52 g/mol. Its IUPAC name is 2-[9,9-bis[2-[2-(2-methoxyethoxy)ethoxy]ethyl]-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)fluoren-1-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[9,9-bis[2-[2-(2-methoxyethoxy)ethoxy]ethyl]-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)fluoren-1-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 139249373 |
| Molecular Formula | C39H60B2O10 |
| Molecular Weight | 710.52 g/mol |
| Exact Mass | 710.44 |
| IUPAC Name | 2-[9,9-bis[2-[2-(2-methoxyethoxy)ethoxy]ethyl]-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)fluoren-1-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | COCCOCCOCCC1(CCOCCOCCOC)c2cc(B3OC(C)(C)C(C)(C)O3)ccc2-c2cccc(B3OC(C)(C)C(C)(C)O3)c21 |
| InChI | InChI=1S/C39H60B2O10/c1-35(2)36(3,4)49-40(48-35)29-14-15-30-31-12-11-13-33(41-50-37(5,6)38(7,8)51-41)34(31)39(32(30)28-29,16-18-44-24-26-46-22-20-42-9)17-19-45-25-27-47-23-21-43-10/h11-15,28H,16-27H2,1-10H3 |
| InChIKey | NHGKXKUESODSCA-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 92.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 51 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 710.52 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|