C19H25BrO6 — CID 139249518
methyl (3S,5S,6S)-5-(bromomethyl)-12,12-dimethoxy-6-methyl-13-oxo-14-oxatetracyclo[7.2.2.13,6.02,8]tetradec-2(8)-ene-10-carboxylate (PubChem CID 139249518) has the molecular formula C19H25BrO6 and a molecular weight of 429.31 g/mol. Its IUPAC name is methyl (3S,5S,6S)-5-(bromomethyl)-12,12-dimethoxy-6-methyl-13-oxo-14-oxatetracyclo[7.2.2.13,6.02,8]tetradec-2(8)-ene-10-carboxylate.
| Compound Name | methyl (3S,5S,6S)-5-(bromomethyl)-12,12-dimethoxy-6-methyl-13-oxo-14-oxatetracyclo[7.2.2.13,6.02,8]tetradec-2(8)-ene-10-carboxylate |
|---|---|
| PubChem CID | 139249518 |
| Molecular Formula | C19H25BrO6 |
| Molecular Weight | 429.31 g/mol |
| Exact Mass | 428.08 |
| IUPAC Name | methyl (3S,5S,6S)-5-(bromomethyl)-12,12-dimethoxy-6-methyl-13-oxo-14-oxatetracyclo[7.2.2.13,6.02,8]tetradec-2(8)-ene-10-carboxylate |
| SMILES | COC(=O)C1CC2C3=C(C[C@]4(C)O[C@H]3C[C@@H]4CBr)C1C(=O)C2(OC)OC |
| InChI | InChI=1S/C19H25BrO6/c1-18-7-11-14-10(17(22)23-2)6-12(19(24-3,25-4)16(14)21)15(11)13(26-18)5-9(18)8-20/h9-10,12-14H,5-8H2,1-4H3/t9-,10?,12?,13+,14?,18+/m1/s1 |
| InChIKey | UAYPUBYUXJIOKQ-HOKAZSHGSA-N |
| XLogP | 2.24 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.31 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|