C12H16O3 — CID 139249540
(1R,5S,6S,9R)-5,9-dimethyl-8,10-dioxatricyclo[7.2.1.01,6]dodec-2-en-4-one (PubChem CID 139249540) has the molecular formula C12H16O3 and a molecular weight of 208.26 g/mol. Its IUPAC name is (1R,5S,6S,9R)-5,9-dimethyl-8,10-dioxatricyclo[7.2.1.01,6]dodec-2-en-4-one.
| Compound Name | (1R,5S,6S,9R)-5,9-dimethyl-8,10-dioxatricyclo[7.2.1.01,6]dodec-2-en-4-one |
|---|---|
| PubChem CID | 139249540 |
| Molecular Formula | C12H16O3 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.11 |
| IUPAC Name | (1R,5S,6S,9R)-5,9-dimethyl-8,10-dioxatricyclo[7.2.1.01,6]dodec-2-en-4-one |
| SMILES | C[C@@H]1C(=O)C=C[C@]23CO[C@](C)(C2)OC[C@@H]13 |
| InChI | InChI=1S/C12H16O3/c1-8-9-5-14-11(2)6-12(9,7-15-11)4-3-10(8)13/h3-4,8-9H,5-7H2,1-2H3/t8-,9-,11+,12+/m0/s1 |
| InChIKey | GKRXASVKPCJXIH-GAIPPQHRSA-N |
| XLogP | 1.53 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |