C48H24FeN4O8-3 — CID 139249654
iron(3+);4-[10,15,20-tris(4-carboxylatophenyl)porphyrin-22,24-diid-5-yl]benzoate (PubChem CID 139249654) has the molecular formula C48H24FeN4O8-3 and a molecular weight of 840.59 g/mol. Its IUPAC name is iron(3+);4-[10,15,20-tris(4-carboxylatophenyl)porphyrin-22,24-diid-5-yl]benzoate.
| Compound Name | iron(3+);4-[10,15,20-tris(4-carboxylatophenyl)porphyrin-22,24-diid-5-yl]benzoate |
|---|---|
| PubChem CID | 139249654 |
| Molecular Formula | C48H24FeN4O8-3 |
| Molecular Weight | 840.59 g/mol |
| Exact Mass | 840.10 |
| IUPAC Name | iron(3+);4-[10,15,20-tris(4-carboxylatophenyl)porphyrin-22,24-diid-5-yl]benzoate |
| SMILES | O=C([O-])c1ccc(-c2c3nc(c(-c4ccc(C(=O)[O-])cc4)c4ccc([n-]4)c(-c4ccc(C(=O)[O-])cc4)c4nc(c(-c5ccc(C(=O)[O-])cc5)c5ccc2[n-]5)C=C4)C=C3)cc1.[Fe+3] |
| InChI | InChI=1S/C48H30N4O8.Fe/c53-45(54)29-9-1-25(2-10-29)41-33-17-19-35(49-33)42(26-3-11-30(12-4-26)46(55)56)37-21-23-39(51-37)44(28-7-15-32(16-8-28)48(59)60)40-24-22-38(52-40)43(36-20-18-34(41)50-36)27-5-13-31(14-6-27)47(57)58;/h1-24H,(H6,49,50,51,52,53,54,55,56,57,58,59,60);/q;+3/p-6/b41-33-,41-34-,42-35-,42-37-,43-36-,43-38-,44-39-,44-40-; |
| InChIKey | BFWJKRRMHJHTER-DAJBKUBHSA-H |
| XLogP | 4.03 |
| TPSA | 214.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 61 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 840.59 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|