C28H40O4Si — CID 139249711
2-[(4S,6R)-6-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-2,2-dimethyl-1,3-dioxan-4-yl]-2-methylpropanal (PubChem CID 139249711) has the molecular formula C28H40O4Si and a molecular weight of 468.71 g/mol. Its IUPAC name is 2-[(4S,6R)-6-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-2,2-dimethyl-1,3-dioxan-4-yl]-2-methylpropanal.
| Compound Name | 2-[(4S,6R)-6-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-2,2-dimethyl-1,3-dioxan-4-yl]-2-methylpropanal |
|---|---|
| PubChem CID | 139249711 |
| Molecular Formula | C28H40O4Si |
| Molecular Weight | 468.71 g/mol |
| Exact Mass | 468.27 |
| IUPAC Name | 2-[(4S,6R)-6-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-2,2-dimethyl-1,3-dioxan-4-yl]-2-methylpropanal |
| SMILES | CC1(C)O[C@H](CCO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)C[C@@H](C(C)(C)C=O)O1 |
| InChI | InChI=1S/C28H40O4Si/c1-26(2,3)33(23-14-10-8-11-15-23,24-16-12-9-13-17-24)30-19-18-22-20-25(27(4,5)21-29)32-28(6,7)31-22/h8-17,21-22,25H,18-20H2,1-7H3/t22-,25+/m1/s1 |
| InChIKey | ULTHSKZWSDKHAH-RDGATRHJSA-N |
| XLogP | 5.09 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.71 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|