C22H34O9 — CID 139249728
methyl (2E)-2-[(2S,3S,6S)-3-acetyloxy-2-methoxy-2-(2-methyl-1-oxopropan-2-yl)-6-[[(4R,5R)-2,2,5-trimethyl-1,3-dioxolan-4-yl]methyl]oxan-4-ylidene]acetate (PubChem CID 139249728) has the molecular formula C22H34O9 and a molecular weight of 442.51 g/mol. Its IUPAC name is methyl (2E)-2-[(2S,3S,6S)-3-acetyloxy-2-methoxy-2-(2-methyl-1-oxopropan-2-yl)-6-[[(4R,5R)-2,2,5-trimethyl-1,3-dioxolan-4-yl]methyl]oxan-4-ylidene]acetate.
| Compound Name | methyl (2E)-2-[(2S,3S,6S)-3-acetyloxy-2-methoxy-2-(2-methyl-1-oxopropan-2-yl)-6-[[(4R,5R)-2,2,5-trimethyl-1,3-dioxolan-4-yl]methyl]oxan-4-ylidene]acetate |
|---|---|
| PubChem CID | 139249728 |
| Molecular Formula | C22H34O9 |
| Molecular Weight | 442.51 g/mol |
| Exact Mass | 442.22 |
| IUPAC Name | methyl (2E)-2-[(2S,3S,6S)-3-acetyloxy-2-methoxy-2-(2-methyl-1-oxopropan-2-yl)-6-[[(4R,5R)-2,2,5-trimethyl-1,3-dioxolan-4-yl]methyl]oxan-4-ylidene]acetate |
| SMILES | COC(=O)/C=C1\C[C@@H](C[C@H]2OC(C)(C)O[C@@H]2C)O[C@@](OC)(C(C)(C)C=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C22H34O9/c1-13-17(31-21(5,6)29-13)11-16-9-15(10-18(25)26-7)19(28-14(2)24)22(27-8,30-16)20(3,4)12-23/h10,12-13,16-17,19H,9,11H2,1-8H3/b15-10+/t13-,16+,17-,19+,22-/m1/s1 |
| InChIKey | ZJQNUJMIPMBPPE-TUAFSIFISA-N |
| XLogP | 2.30 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.51 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|