C29H44O5Si — CID 139249748
(3S)-4-[(2R,6S)-6-[(2S)-2-[tert-butyl(diphenyl)silyl]oxy-4-hydroxybutyl]oxan-2-yl]butane-1,3-diol (PubChem CID 139249748) has the molecular formula C29H44O5Si and a molecular weight of 500.75 g/mol. Its IUPAC name is (3S)-4-[(2R,6S)-6-[(2S)-2-[tert-butyl(diphenyl)silyl]oxy-4-hydroxybutyl]oxan-2-yl]butane-1,3-diol.
| Compound Name | (3S)-4-[(2R,6S)-6-[(2S)-2-[tert-butyl(diphenyl)silyl]oxy-4-hydroxybutyl]oxan-2-yl]butane-1,3-diol |
|---|---|
| PubChem CID | 139249748 |
| Molecular Formula | C29H44O5Si |
| Molecular Weight | 500.75 g/mol |
| Exact Mass | 500.30 |
| IUPAC Name | (3S)-4-[(2R,6S)-6-[(2S)-2-[tert-butyl(diphenyl)silyl]oxy-4-hydroxybutyl]oxan-2-yl]butane-1,3-diol |
| SMILES | CC(C)(C)[Si](O[C@@H](CCO)C[C@@H]1CCC[C@H](C[C@@H](O)CCO)O1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C29H44O5Si/c1-29(2,3)35(27-13-6-4-7-14-27,28-15-8-5-9-16-28)34-26(18-20-31)22-25-12-10-11-24(33-25)21-23(32)17-19-30/h4-9,13-16,23-26,30-32H,10-12,17-22H2,1-3H3/t23-,24+,25-,26-/m0/s1 |
| InChIKey | AYSQEKDGNSLTCB-QYOOZWMWSA-N |
| XLogP | 3.78 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.75 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|