C26H56O4Si3 — CID 139249823
2-[[(2R,3R,5S)-2,5-bis[[tert-butyl(dimethyl)silyl]oxy]oct-7-yn-3-yl]oxymethoxy]ethyl-trimethylsilane (PubChem CID 139249823) has the molecular formula C26H56O4Si3 and a molecular weight of 516.99 g/mol. Its IUPAC name is 2-[[(2R,3R,5S)-2,5-bis[[tert-butyl(dimethyl)silyl]oxy]oct-7-yn-3-yl]oxymethoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[(2R,3R,5S)-2,5-bis[[tert-butyl(dimethyl)silyl]oxy]oct-7-yn-3-yl]oxymethoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 139249823 |
| Molecular Formula | C26H56O4Si3 |
| Molecular Weight | 516.99 g/mol |
| Exact Mass | 516.35 |
| IUPAC Name | 2-[[(2R,3R,5S)-2,5-bis[[tert-butyl(dimethyl)silyl]oxy]oct-7-yn-3-yl]oxymethoxy]ethyl-trimethylsilane |
| SMILES | C#CC[C@@H](C[C@@H](OCOCC[Si](C)(C)C)[C@@H](C)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C26H56O4Si3/c1-16-17-23(30-33(14,15)26(6,7)8)20-24(28-21-27-18-19-31(9,10)11)22(2)29-32(12,13)25(3,4)5/h1,22-24H,17-21H2,2-15H3/t22-,23+,24-/m1/s1 |
| InChIKey | GBSYENMDWGTZSA-TZRRMPRUSA-N |
| XLogP | 7.90 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.99 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|