C28H58O6Si3 — CID 139249828
methyl (5S,7R,8R)-5,8-bis[[tert-butyl(dimethyl)silyl]oxy]-7-(2-trimethylsilylethoxymethoxy)non-2-ynoate (PubChem CID 139249828) has the molecular formula C28H58O6Si3 and a molecular weight of 575.02 g/mol. Its IUPAC name is methyl (5S,7R,8R)-5,8-bis[[tert-butyl(dimethyl)silyl]oxy]-7-(2-trimethylsilylethoxymethoxy)non-2-ynoate.
| Compound Name | methyl (5S,7R,8R)-5,8-bis[[tert-butyl(dimethyl)silyl]oxy]-7-(2-trimethylsilylethoxymethoxy)non-2-ynoate |
|---|---|
| PubChem CID | 139249828 |
| Molecular Formula | C28H58O6Si3 |
| Molecular Weight | 575.02 g/mol |
| Exact Mass | 574.35 |
| IUPAC Name | methyl (5S,7R,8R)-5,8-bis[[tert-butyl(dimethyl)silyl]oxy]-7-(2-trimethylsilylethoxymethoxy)non-2-ynoate |
| SMILES | COC(=O)C#CC[C@@H](C[C@@H](OCOCC[Si](C)(C)C)[C@@H](C)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C28H58O6Si3/c1-23(33-36(12,13)27(2,3)4)25(32-22-31-19-20-35(9,10)11)21-24(17-16-18-26(29)30-8)34-37(14,15)28(5,6)7/h23-25H,17,19-22H2,1-15H3/t23-,24+,25-/m1/s1 |
| InChIKey | NYBIKKAHKVDPHO-DSNGMDLFSA-N |
| XLogP | 7.44 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.02 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_5', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|