About tert-butyl-[(2R,3R)-2-[tert-butyl(dimethyl)silyl]oxyhex-5-en-3-yl]oxy-dimethylsilane
tert-butyl-[(2R,3R)-2-[tert-butyl(dimethyl)silyl]oxyhex-5-en-3-yl]oxy-dimethylsilane (PubChem CID 139249864) has the molecular formula C18H40O2Si2
and a molecular weight of 344.69 g/mol. Its IUPAC name is tert-butyl-[(2R,3R)-2-[tert-butyl(dimethyl)silyl]oxyhex-5-en-3-yl]oxy-dimethylsilane.
Molecular Properties
| Compound Name | tert-butyl-[(2R,3R)-2-[tert-butyl(dimethyl)silyl]oxyhex-5-en-3-yl]oxy-dimethylsilane |
| PubChem CID | 139249864 |
| Molecular Formula | C18H40O2Si2 |
| Molecular Weight | 344.69 g/mol |
| Exact Mass | 344.26 |
| IUPAC Name | tert-butyl-[(2R,3R)-2-[tert-butyl(dimethyl)silyl]oxyhex-5-en-3-yl]oxy-dimethylsilane |
| SMILES | C=CC[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H40O2Si2/c1-13-14-16(20-22(11,12)18(6,7)8)15(2)19-21(9,10)17(3,4)5/h13,15-16H,1,14H2,2-12H3/t15-,16-/m1/s1 |
| InChIKey | IGDPCFUZNCOHRO-HZPDHXFCSA-N |
| XLogP | 6.36 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 344.69 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl-[(2R,3R)-2-[tert-butyl(dimethyl)silyl]oxyhex-5-en-3-yl]oxy-dimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl-[(2R,3R)-2-[tert-butyl(dimethyl)silyl]oxyhex-5-en-3-yl]oxy-dimethylsilane?
The IUPAC name of tert-butyl-[(2R,3R)-2-[tert-butyl(dimethyl)silyl]oxyhex-5-en-3-yl]oxy-dimethylsilane (CID 139249864) is tert-butyl-[(2R,3R)-2-[tert-butyl(dimethyl)silyl]oxyhex-5-en-3-yl]oxy-dimethylsilane.
What is the SMILES notation for tert-butyl-[(2R,3R)-2-[tert-butyl(dimethyl)silyl]oxyhex-5-en-3-yl]oxy-dimethylsilane?
The canonical SMILES for tert-butyl-[(2R,3R)-2-[tert-butyl(dimethyl)silyl]oxyhex-5-en-3-yl]oxy-dimethylsilane is C=CC[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)O[Si](C)(C)C(C)(C)C.
What is the InChIKey of tert-butyl-[(2R,3R)-2-[tert-butyl(dimethyl)silyl]oxyhex-5-en-3-yl]oxy-dimethylsilane?
The InChIKey is IGDPCFUZNCOHRO-HZPDHXFCSA-N. The full InChI is InChI=1S/C18H40O2Si2/c1-13-14-16(20-22(11,12)18(6,7)8)15(2)19-21(9,10)17(3,4)5/h13,15-16H,1,14H2,2-12H3/t15-,16-/m1/s1.
What are the key properties of tert-butyl-[(2R,3R)-2-[tert-butyl(dimethyl)silyl]oxyhex-5-en-3-yl]oxy-dimethylsilane?
tert-butyl-[(2R,3R)-2-[tert-butyl(dimethyl)silyl]oxyhex-5-en-3-yl]oxy-dimethylsilane has a molecular weight of 344.69 g/mol, XLogP of 6.36, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl-[(2R,3R)-2-[tert-butyl(dimethyl)silyl]oxyhex-5-en-3-yl]oxy-dimethylsilane is sourced from PubChem (CID 139249864), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).