C19H44O4Si2 — CID 139249867
(3S,5R,6R)-5,6-bis[[tert-butyl(dimethyl)silyl]oxy]heptane-1,3-diol (PubChem CID 139249867) has the molecular formula C19H44O4Si2 and a molecular weight of 392.73 g/mol. Its IUPAC name is (3S,5R,6R)-5,6-bis[[tert-butyl(dimethyl)silyl]oxy]heptane-1,3-diol.
| Compound Name | (3S,5R,6R)-5,6-bis[[tert-butyl(dimethyl)silyl]oxy]heptane-1,3-diol |
|---|---|
| PubChem CID | 139249867 |
| Molecular Formula | C19H44O4Si2 |
| Molecular Weight | 392.73 g/mol |
| Exact Mass | 392.28 |
| IUPAC Name | (3S,5R,6R)-5,6-bis[[tert-butyl(dimethyl)silyl]oxy]heptane-1,3-diol |
| SMILES | C[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](C[C@@H](O)CCO)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C19H44O4Si2/c1-15(22-24(8,9)18(2,3)4)17(14-16(21)12-13-20)23-25(10,11)19(5,6)7/h15-17,20-21H,12-14H2,1-11H3/t15-,16+,17-/m1/s1 |
| InChIKey | QAVXYPQZNUBYDM-IXDOHACOSA-N |
| XLogP | 4.92 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.73 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|