C22H38O6 — CID 139250124
(1R,2R,3S,5S,7S,8R,10S,12R,13R,16R)-1,2,3,6,6,12-hexamethyltetracyclo[8.5.1.03,7.013,16]hexadecane-2,5,7,8,10,12-hexol (PubChem CID 139250124) has the molecular formula C22H38O6 and a molecular weight of 398.54 g/mol. Its IUPAC name is (1R,2R,3S,5S,7S,8R,10S,12R,13R,16R)-1,2,3,6,6,12-hexamethyltetracyclo[8.5.1.03,7.013,16]hexadecane-2,5,7,8,10,12-hexol.
| Compound Name | (1R,2R,3S,5S,7S,8R,10S,12R,13R,16R)-1,2,3,6,6,12-hexamethyltetracyclo[8.5.1.03,7.013,16]hexadecane-2,5,7,8,10,12-hexol |
|---|---|
| PubChem CID | 139250124 |
| Molecular Formula | C22H38O6 |
| Molecular Weight | 398.54 g/mol |
| Exact Mass | 398.27 |
| IUPAC Name | (1R,2R,3S,5S,7S,8R,10S,12R,13R,16R)-1,2,3,6,6,12-hexamethyltetracyclo[8.5.1.03,7.013,16]hexadecane-2,5,7,8,10,12-hexol |
| SMILES | CC1(C)[C@@H](O)C[C@@]2(C)[C@](C)(O)[C@]3(C)CC[C@@H]4[C@H]3[C@](O)(C[C@@H](O)[C@]12O)C[C@@]4(C)O |
| InChI | InChI=1S/C22H38O6/c1-16(2)13(23)9-19(5)20(6,26)17(3)8-7-12-15(17)21(27,11-18(12,4)25)10-14(24)22(16,19)28/h12-15,23-28H,7-11H2,1-6H3/t12-,13+,14-,15-,17-,18-,19+,20-,21+,22+/m1/s1 |
| InChIKey | JEINOEZPUXGETN-NYVHAQJWSA-N |
| XLogP | 0.95 |
| TPSA | 121.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.54 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |