C29H48O3Si — CID 139250127
(1S,7S,9Z,14S)-14-[tert-butyl(dimethyl)silyl]peroxy-10-methyl-6-[(2S)-6-methylhept-5-en-2-yl]tricyclo[9.3.0.03,7]tetradeca-3,9-dien-5-one (PubChem CID 139250127) has the molecular formula C29H48O3Si and a molecular weight of 472.79 g/mol. Its IUPAC name is (1S,7S,9Z,14S)-14-[tert-butyl(dimethyl)silyl]peroxy-10-methyl-6-[(2S)-6-methylhept-5-en-2-yl]tricyclo[9.3.0.03,7]tetradeca-3,9-dien-5-one.
| Compound Name | (1S,7S,9Z,14S)-14-[tert-butyl(dimethyl)silyl]peroxy-10-methyl-6-[(2S)-6-methylhept-5-en-2-yl]tricyclo[9.3.0.03,7]tetradeca-3,9-dien-5-one |
|---|---|
| PubChem CID | 139250127 |
| Molecular Formula | C29H48O3Si |
| Molecular Weight | 472.79 g/mol |
| Exact Mass | 472.34 |
| IUPAC Name | (1S,7S,9Z,14S)-14-[tert-butyl(dimethyl)silyl]peroxy-10-methyl-6-[(2S)-6-methylhept-5-en-2-yl]tricyclo[9.3.0.03,7]tetradeca-3,9-dien-5-one |
| SMILES | CC(C)=CCC[C@H](C)C1C(=O)C=C2C[C@H]3C(CC[C@@H]3OO[Si](C)(C)C(C)(C)C)/C(C)=C\C[C@H]21 |
| InChI | InChI=1S/C29H48O3Si/c1-19(2)11-10-12-21(4)28-24-14-13-20(3)23-15-16-27(25(23)17-22(24)18-26(28)30)31-32-33(8,9)29(5,6)7/h11,13,18,21,23-25,27-28H,10,12,14-17H2,1-9H3/b20-13-/t21-,23?,24+,25-,27-,28?/m0/s1 |
| InChIKey | PLSXVLSRKAWBPP-RJCCJRCRSA-N |
| XLogP | 8.20 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.79 |
| LogP ≤ 5 | 8.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|