C12H16O2 — CID 139250131
(1E,8E)-6,13-dioxatricyclo[9.3.0.04,8]tetradeca-1,8-diene (PubChem CID 139250131) has the molecular formula C12H16O2 and a molecular weight of 192.26 g/mol. Its IUPAC name is (1E,8E)-6,13-dioxatricyclo[9.3.0.04,8]tetradeca-1,8-diene.
| Compound Name | (1E,8E)-6,13-dioxatricyclo[9.3.0.04,8]tetradeca-1,8-diene |
|---|---|
| PubChem CID | 139250131 |
| Molecular Formula | C12H16O2 |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.12 |
| IUPAC Name | (1E,8E)-6,13-dioxatricyclo[9.3.0.04,8]tetradeca-1,8-diene |
| SMILES | C1=C2/COCC2C/C=C2/COCC2C/1 |
| InChI | InChI=1S/C12H16O2/c1-2-10-6-14-8-12(10)4-3-11-7-13-5-9(1)11/h1,4,10-11H,2-3,5-8H2/b9-1-,12-4- |
| InChIKey | AQGCNYXWRHGMAF-XJGKRTTDSA-N |
| XLogP | 1.93 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|