C10H15N — CID 139250154
(3aR,5Z,8Z,9aS)-2,3,3a,4,7,9a-hexahydro-1H-cycloocta[c]pyrrole (PubChem CID 139250154) has the molecular formula C10H15N and a molecular weight of 149.24 g/mol. Its IUPAC name is (3aR,5Z,8Z,9aS)-2,3,3a,4,7,9a-hexahydro-1H-cycloocta[c]pyrrole.
| Compound Name | (3aR,5Z,8Z,9aS)-2,3,3a,4,7,9a-hexahydro-1H-cycloocta[c]pyrrole |
|---|---|
| PubChem CID | 139250154 |
| Molecular Formula | C10H15N |
| Molecular Weight | 149.24 g/mol |
| Exact Mass | 149.12 |
| IUPAC Name | (3aR,5Z,8Z,9aS)-2,3,3a,4,7,9a-hexahydro-1H-cycloocta[c]pyrrole |
| SMILES | C1=C\C[C@H]2CNC[C@H]2/C=C\C/1 |
| InChI | InChI=1S/C10H15N/c1-2-4-6-10-8-11-7-9(10)5-3-1/h1,3-4,6,9-11H,2,5,7-8H2/b3-1-,6-4-/t9-,10+/m0/s1 |
| InChIKey | AJOHVZVPSDYQNW-CEWQCNBESA-N |
| XLogP | 1.73 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.24 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|