C11H17N — CID 139250155
(3aS,4Z,6S,7Z,9aR)-6-methyl-2,3,3a,6,9,9a-hexahydro-1H-cycloocta[c]pyrrole (PubChem CID 139250155) has the molecular formula C11H17N and a molecular weight of 163.26 g/mol. Its IUPAC name is (3aS,4Z,6S,7Z,9aR)-6-methyl-2,3,3a,6,9,9a-hexahydro-1H-cycloocta[c]pyrrole.
| Compound Name | (3aS,4Z,6S,7Z,9aR)-6-methyl-2,3,3a,6,9,9a-hexahydro-1H-cycloocta[c]pyrrole |
|---|---|
| PubChem CID | 139250155 |
| Molecular Formula | C11H17N |
| Molecular Weight | 163.26 g/mol |
| Exact Mass | 163.14 |
| IUPAC Name | (3aS,4Z,6S,7Z,9aR)-6-methyl-2,3,3a,6,9,9a-hexahydro-1H-cycloocta[c]pyrrole |
| SMILES | C[C@H]1/C=C\C[C@H]2CNC[C@H]2/C=C\1 |
| InChI | InChI=1S/C11H17N/c1-9-3-2-4-10-7-12-8-11(10)6-5-9/h2-3,5-6,9-12H,4,7-8H2,1H3/b3-2-,6-5-/t9-,10-,11+/m0/s1 |
| InChIKey | UJLCDJTUBPHDLQ-VIDLWBJNSA-N |
| XLogP | 1.97 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.26 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|