C11H17N — CID 139250157
(3aR,5Z,8Z,9aS)-8-methyl-2,3,3a,4,7,9a-hexahydro-1H-cycloocta[c]pyrrole (PubChem CID 139250157) has the molecular formula C11H17N and a molecular weight of 163.26 g/mol. Its IUPAC name is (3aR,5Z,8Z,9aS)-8-methyl-2,3,3a,4,7,9a-hexahydro-1H-cycloocta[c]pyrrole.
| Compound Name | (3aR,5Z,8Z,9aS)-8-methyl-2,3,3a,4,7,9a-hexahydro-1H-cycloocta[c]pyrrole |
|---|---|
| PubChem CID | 139250157 |
| Molecular Formula | C11H17N |
| Molecular Weight | 163.26 g/mol |
| Exact Mass | 163.14 |
| IUPAC Name | (3aR,5Z,8Z,9aS)-8-methyl-2,3,3a,4,7,9a-hexahydro-1H-cycloocta[c]pyrrole |
| SMILES | C/C1=C/[C@@H]2CNC[C@@H]2C/C=C\C1 |
| InChI | InChI=1S/C11H17N/c1-9-4-2-3-5-10-7-12-8-11(10)6-9/h2-3,6,10-12H,4-5,7-8H2,1H3/b3-2-,9-6-/t10-,11+/m0/s1 |
| InChIKey | FDKCDJHWIMQXGJ-VZXLTSOZSA-N |
| XLogP | 2.12 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.26 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|