C12H19N — CID 139250158
(3aS,4Z,6S,7Z,9aR)-5,6-dimethyl-2,3,3a,6,9,9a-hexahydro-1H-cycloocta[c]pyrrole (PubChem CID 139250158) has the molecular formula C12H19N and a molecular weight of 177.29 g/mol. Its IUPAC name is (3aS,4Z,6S,7Z,9aR)-5,6-dimethyl-2,3,3a,6,9,9a-hexahydro-1H-cycloocta[c]pyrrole.
| Compound Name | (3aS,4Z,6S,7Z,9aR)-5,6-dimethyl-2,3,3a,6,9,9a-hexahydro-1H-cycloocta[c]pyrrole |
|---|---|
| PubChem CID | 139250158 |
| Molecular Formula | C12H19N |
| Molecular Weight | 177.29 g/mol |
| Exact Mass | 177.15 |
| IUPAC Name | (3aS,4Z,6S,7Z,9aR)-5,6-dimethyl-2,3,3a,6,9,9a-hexahydro-1H-cycloocta[c]pyrrole |
| SMILES | C/C1=C/[C@@H]2CNC[C@@H]2C/C=C\[C@@H]1C |
| InChI | InChI=1S/C12H19N/c1-9-4-3-5-11-7-13-8-12(11)6-10(9)2/h3-4,6,9,11-13H,5,7-8H2,1-2H3/b4-3-,10-6-/t9-,11-,12+/m0/s1 |
| InChIKey | PKZJNQFGVYWIPP-ZNQOSIPMSA-N |
| XLogP | 2.36 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.29 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|