C14H23N — CID 139250159
(3aS,4Z,6S,7Z,9aR)-5-methyl-6-propan-2-yl-2,3,3a,6,9,9a-hexahydro-1H-cycloocta[c]pyrrole (PubChem CID 139250159) has the molecular formula C14H23N and a molecular weight of 205.34 g/mol. Its IUPAC name is (3aS,4Z,6S,7Z,9aR)-5-methyl-6-propan-2-yl-2,3,3a,6,9,9a-hexahydro-1H-cycloocta[c]pyrrole.
| Compound Name | (3aS,4Z,6S,7Z,9aR)-5-methyl-6-propan-2-yl-2,3,3a,6,9,9a-hexahydro-1H-cycloocta[c]pyrrole |
|---|---|
| PubChem CID | 139250159 |
| Molecular Formula | C14H23N |
| Molecular Weight | 205.34 g/mol |
| Exact Mass | 205.18 |
| IUPAC Name | (3aS,4Z,6S,7Z,9aR)-5-methyl-6-propan-2-yl-2,3,3a,6,9,9a-hexahydro-1H-cycloocta[c]pyrrole |
| SMILES | C/C1=C/[C@@H]2CNC[C@@H]2C/C=C\[C@@H]1C(C)C |
| InChI | InChI=1S/C14H23N/c1-10(2)14-6-4-5-12-8-15-9-13(12)7-11(14)3/h4,6-7,10,12-15H,5,8-9H2,1-3H3/b6-4-,11-7-/t12-,13+,14+/m0/s1 |
| InChIKey | SGXVXSVFMOKNPZ-YCXVUVKASA-N |
| XLogP | 3.00 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.34 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|