C11H17N — CID 139250160
(3aR,5Z,8Z,9aS)-3a-methyl-1,2,3,4,7,9a-hexahydrocycloocta[c]pyrrole (PubChem CID 139250160) has the molecular formula C11H17N and a molecular weight of 163.26 g/mol. Its IUPAC name is (3aR,5Z,8Z,9aS)-3a-methyl-1,2,3,4,7,9a-hexahydrocycloocta[c]pyrrole.
| Compound Name | (3aR,5Z,8Z,9aS)-3a-methyl-1,2,3,4,7,9a-hexahydrocycloocta[c]pyrrole |
|---|---|
| PubChem CID | 139250160 |
| Molecular Formula | C11H17N |
| Molecular Weight | 163.26 g/mol |
| Exact Mass | 163.14 |
| IUPAC Name | (3aR,5Z,8Z,9aS)-3a-methyl-1,2,3,4,7,9a-hexahydrocycloocta[c]pyrrole |
| SMILES | C[C@@]12C/C=C\C/C=C\[C@@H]1CNC2 |
| InChI | InChI=1S/C11H17N/c1-11-7-5-3-2-4-6-10(11)8-12-9-11/h3-6,10,12H,2,7-9H2,1H3/b5-3-,6-4-/t10-,11+/m1/s1 |
| InChIKey | IJHXULFSYCQOJO-GWJOIRRMSA-N |
| XLogP | 2.12 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.26 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|