C12H19N — CID 139250161
(3aS,4Z,6S,7Z,9aR)-6,9a-dimethyl-1,2,3,3a,6,9-hexahydrocycloocta[c]pyrrole (PubChem CID 139250161) has the molecular formula C12H19N and a molecular weight of 177.29 g/mol. Its IUPAC name is (3aS,4Z,6S,7Z,9aR)-6,9a-dimethyl-1,2,3,3a,6,9-hexahydrocycloocta[c]pyrrole.
| Compound Name | (3aS,4Z,6S,7Z,9aR)-6,9a-dimethyl-1,2,3,3a,6,9-hexahydrocycloocta[c]pyrrole |
|---|---|
| PubChem CID | 139250161 |
| Molecular Formula | C12H19N |
| Molecular Weight | 177.29 g/mol |
| Exact Mass | 177.15 |
| IUPAC Name | (3aS,4Z,6S,7Z,9aR)-6,9a-dimethyl-1,2,3,3a,6,9-hexahydrocycloocta[c]pyrrole |
| SMILES | C[C@H]1/C=C\C[C@@]2(C)CNC[C@H]2/C=C\1 |
| InChI | InChI=1S/C12H19N/c1-10-4-3-7-12(2)9-13-8-11(12)6-5-10/h3-6,10-11,13H,7-9H2,1-2H3/b4-3-,6-5-/t10-,11+,12-/m0/s1 |
| InChIKey | BOQZCCQVJQJOQD-FCVDZRBDSA-N |
| XLogP | 2.36 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.29 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|