About 2-bromo-1-(4,6-dihydropyren-1-yl)ethanone
2-bromo-1-(4,6-dihydropyren-1-yl)ethanone (PubChem CID 139250452) has the molecular formula C18H13BrO
and a molecular weight of 325.21 g/mol. Its IUPAC name is 2-bromo-1-(4,6-dihydropyren-1-yl)ethanone.
Molecular Properties
| Compound Name | 2-bromo-1-(4,6-dihydropyren-1-yl)ethanone |
| PubChem CID | 139250452 |
| Molecular Formula | C18H13BrO |
| Molecular Weight | 325.21 g/mol |
| Exact Mass | 324.01 |
| IUPAC Name | 2-bromo-1-(4,6-dihydropyren-1-yl)ethanone |
| SMILES | O=C(CBr)c1ccc2c3c4c(ccc13)C=CCC4=CC2 |
| InChI | InChI=1S/C18H13BrO/c19-10-16(20)14-8-6-13-5-4-11-2-1-3-12-7-9-15(14)18(13)17(11)12/h1,3-4,6-9H,2,5,10H2 |
| InChIKey | HXNHIRYDXJLCPM-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.21 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-1-(4,6-dihydropyren-1-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-1-(4,6-dihydropyren-1-yl)ethanone?
The IUPAC name of 2-bromo-1-(4,6-dihydropyren-1-yl)ethanone (CID 139250452) is 2-bromo-1-(4,6-dihydropyren-1-yl)ethanone.
What is the SMILES notation for 2-bromo-1-(4,6-dihydropyren-1-yl)ethanone?
The canonical SMILES for 2-bromo-1-(4,6-dihydropyren-1-yl)ethanone is O=C(CBr)c1ccc2c3c4c(ccc13)C=CCC4=CC2.
What is the InChIKey of 2-bromo-1-(4,6-dihydropyren-1-yl)ethanone?
The InChIKey is HXNHIRYDXJLCPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H13BrO/c19-10-16(20)14-8-6-13-5-4-11-2-1-3-12-7-9-15(14)18(13)17(11)12/h1,3-4,6-9H,2,5,10H2.
What are the key properties of 2-bromo-1-(4,6-dihydropyren-1-yl)ethanone?
2-bromo-1-(4,6-dihydropyren-1-yl)ethanone has a molecular weight of 325.21 g/mol, XLogP of 4.77, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-1-(4,6-dihydropyren-1-yl)ethanone is sourced from PubChem (CID 139250452), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).