C49H51N3O3S3 — CID 139250900
3-hexyl-5-[7-[4-hexyl-5-[(E)-2-[4-(4-methoxy-N-(4-methoxyphenyl)anilino)phenyl]ethenyl]thiophen-2-yl]-2,1,3-benzothiadiazol-4-yl]thiophene-2-carbaldehyde (PubChem CID 139250900) has the molecular formula C49H51N3O3S3 and a molecular weight of 826.17 g/mol. Its IUPAC name is 3-hexyl-5-[7-[4-hexyl-5-[(E)-2-[4-(4-methoxy-N-(4-methoxyphenyl)anilino)phenyl]ethenyl]thiophen-2-yl]-2,1,3-benzothiadiazol-4-yl]thiophene-2-carbaldehyde.
| Compound Name | 3-hexyl-5-[7-[4-hexyl-5-[(E)-2-[4-(4-methoxy-N-(4-methoxyphenyl)anilino)phenyl]ethenyl]thiophen-2-yl]-2,1,3-benzothiadiazol-4-yl]thiophene-2-carbaldehyde |
|---|---|
| PubChem CID | 139250900 |
| Molecular Formula | C49H51N3O3S3 |
| Molecular Weight | 826.17 g/mol |
| Exact Mass | 825.31 |
| IUPAC Name | 3-hexyl-5-[7-[4-hexyl-5-[(E)-2-[4-(4-methoxy-N-(4-methoxyphenyl)anilino)phenyl]ethenyl]thiophen-2-yl]-2,1,3-benzothiadiazol-4-yl]thiophene-2-carbaldehyde |
| SMILES | CCCCCCc1cc(-c2ccc(-c3cc(CCCCCC)c(/C=C/c4ccc(N(c5ccc(OC)cc5)c5ccc(OC)cc5)cc4)s3)c3nsnc23)sc1C=O |
| InChI | InChI=1S/C49H51N3O3S3/c1-5-7-9-11-13-35-31-45(42-28-29-43(49-48(42)50-58-51-49)46-32-36(47(33-53)57-46)14-12-10-8-6-2)56-44(35)30-17-34-15-18-37(19-16-34)52(38-20-24-40(54-3)25-21-38)39-22-26-41(55-4)27-23-39/h15-33H,5-14H2,1-4H3/b30-17+ |
| InChIKey | ZBRJIIURPSGTIR-OCSSWDANSA-N |
| XLogP | 14.86 |
| TPSA | 64.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 826.17 |
| LogP ≤ 5 | 14.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|