C20H28F3NO — CID 139250958
2,2,2-trifluoro-N-hexyl-N-[(E,3S)-1-phenylhex-4-en-3-yl]acetamide (PubChem CID 139250958) has the molecular formula C20H28F3NO and a molecular weight of 355.44 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-hexyl-N-[(E,3S)-1-phenylhex-4-en-3-yl]acetamide.
| Compound Name | 2,2,2-trifluoro-N-hexyl-N-[(E,3S)-1-phenylhex-4-en-3-yl]acetamide |
|---|---|
| PubChem CID | 139250958 |
| Molecular Formula | C20H28F3NO |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.21 |
| IUPAC Name | 2,2,2-trifluoro-N-hexyl-N-[(E,3S)-1-phenylhex-4-en-3-yl]acetamide |
| SMILES | C/C=C/[C@H](CCc1ccccc1)N(CCCCCC)C(=O)C(F)(F)F |
| InChI | InChI=1S/C20H28F3NO/c1-3-5-6-10-16-24(19(25)20(21,22)23)18(11-4-2)15-14-17-12-8-7-9-13-17/h4,7-9,11-13,18H,3,5-6,10,14-16H2,1-2H3/b11-4+/t18-/m1/s1 |
| InChIKey | FGULIAIBKZITNK-PPCLGBEZSA-N |
| XLogP | 5.54 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|