C25H30F3NO — CID 139250989
[(E,2R)-1,6-diphenylhex-3-en-2-yl] 2,2,2-trifluoro-N-(3-methylbutyl)ethanimidate (PubChem CID 139250989) has the molecular formula C25H30F3NO and a molecular weight of 417.52 g/mol. Its IUPAC name is [(E,2R)-1,6-diphenylhex-3-en-2-yl] 2,2,2-trifluoro-N-(3-methylbutyl)ethanimidate.
| Compound Name | [(E,2R)-1,6-diphenylhex-3-en-2-yl] 2,2,2-trifluoro-N-(3-methylbutyl)ethanimidate |
|---|---|
| PubChem CID | 139250989 |
| Molecular Formula | C25H30F3NO |
| Molecular Weight | 417.52 g/mol |
| Exact Mass | 417.23 |
| IUPAC Name | [(E,2R)-1,6-diphenylhex-3-en-2-yl] 2,2,2-trifluoro-N-(3-methylbutyl)ethanimidate |
| SMILES | CC(C)CC/N=C(/O[C@@H](/C=C/CCc1ccccc1)Cc1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C25H30F3NO/c1-20(2)17-18-29-24(25(26,27)28)30-23(19-22-14-7-4-8-15-22)16-10-9-13-21-11-5-3-6-12-21/h3-8,10-12,14-16,20,23H,9,13,17-19H2,1-2H3/b16-10+,29-24+/t23-/m0/s1 |
| InChIKey | RLKXBBDRWJCLRG-UJMRBFCASA-N |
| XLogP | 6.81 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.52 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|