C23H29NO5 — CID 139251068
[(2R)-2-[(2-methoxy-2-phenylacetyl)amino]-3-methylbutyl] 2-methoxy-2-phenylacetate (PubChem CID 139251068) has the molecular formula C23H29NO5 and a molecular weight of 399.49 g/mol. Its IUPAC name is [(2R)-2-[(2-methoxy-2-phenylacetyl)amino]-3-methylbutyl] 2-methoxy-2-phenylacetate.
| Compound Name | [(2R)-2-[(2-methoxy-2-phenylacetyl)amino]-3-methylbutyl] 2-methoxy-2-phenylacetate |
|---|---|
| PubChem CID | 139251068 |
| Molecular Formula | C23H29NO5 |
| Molecular Weight | 399.49 g/mol |
| Exact Mass | 399.20 |
| IUPAC Name | [(2R)-2-[(2-methoxy-2-phenylacetyl)amino]-3-methylbutyl] 2-methoxy-2-phenylacetate |
| SMILES | COC(C(=O)N[C@@H](COC(=O)C(OC)c1ccccc1)C(C)C)c1ccccc1 |
| InChI | InChI=1S/C23H29NO5/c1-16(2)19(24-22(25)20(27-3)17-11-7-5-8-12-17)15-29-23(26)21(28-4)18-13-9-6-10-14-18/h5-14,16,19-21H,15H2,1-4H3,(H,24,25)/t19-,20?,21?/m0/s1 |
| InChIKey | VJWJGYBQOLVREI-MWXLCCTBSA-N |
| XLogP | 3.45 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.49 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |