C28H19BBr2F2N2O2 — CID 139251143
4,12-bis(2-bromophenoxy)-2,2-difluoro-8-(4-methylphenyl)-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene (PubChem CID 139251143) has the molecular formula C28H19BBr2F2N2O2 and a molecular weight of 624.09 g/mol. Its IUPAC name is 4,12-bis(2-bromophenoxy)-2,2-difluoro-8-(4-methylphenyl)-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene.
| Compound Name | 4,12-bis(2-bromophenoxy)-2,2-difluoro-8-(4-methylphenyl)-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene |
|---|---|
| PubChem CID | 139251143 |
| Molecular Formula | C28H19BBr2F2N2O2 |
| Molecular Weight | 624.09 g/mol |
| Exact Mass | 621.99 |
| IUPAC Name | 4,12-bis(2-bromophenoxy)-2,2-difluoro-8-(4-methylphenyl)-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene |
| SMILES | Cc1ccc(C2=C3C=CC(Oc4ccccc4Br)=[N+]3[B-](F)(F)n3c(Oc4ccccc4Br)ccc32)cc1 |
| InChI | InChI=1S/C28H19BBr2F2N2O2/c1-18-10-12-19(13-11-18)28-22-14-16-26(36-24-8-4-2-6-20(24)30)34(22)29(32,33)35-23(28)15-17-27(35)37-25-9-5-3-7-21(25)31/h2-17H,1H3 |
| InChIKey | WRTQBNBHJWIMAJ-UHFFFAOYSA-N |
| XLogP | 8.17 |
| TPSA | 26.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.09 |
| LogP ≤ 5 | 8.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|