C44H49FeN3P2 — CID 139251651
cyclopenta-1,3-diene;dicyclohexyl-[3-[(1S)-1-(2-diphenylphosphanylcyclopenta-1,4-dien-1-yl)ethyl]-5-phenyltriazol-4-yl]phosphane;iron(2+) (PubChem CID 139251651) has the molecular formula C44H49FeN3P2 and a molecular weight of 737.69 g/mol. Its IUPAC name is cyclopenta-1,3-diene;dicyclohexyl-[3-[(1S)-1-(2-diphenylphosphanylcyclopenta-1,4-dien-1-yl)ethyl]-5-phenyltriazol-4-yl]phosphane;iron(2+).
| Compound Name | cyclopenta-1,3-diene;dicyclohexyl-[3-[(1S)-1-(2-diphenylphosphanylcyclopenta-1,4-dien-1-yl)ethyl]-5-phenyltriazol-4-yl]phosphane;iron(2+) |
|---|---|
| PubChem CID | 139251651 |
| Molecular Formula | C44H49FeN3P2 |
| Molecular Weight | 737.69 g/mol |
| Exact Mass | 737.28 |
| IUPAC Name | cyclopenta-1,3-diene;dicyclohexyl-[3-[(1S)-1-(2-diphenylphosphanylcyclopenta-1,4-dien-1-yl)ethyl]-5-phenyltriazol-4-yl]phosphane;iron(2+) |
| SMILES | C[C@@H](c1cc[cH-]c1P(c1ccccc1)c1ccccc1)n1nnc(-c2ccccc2)c1P(C1CCCCC1)C1CCCCC1.[Fe+2].c1cc[cH-]c1 |
| InChI | InChI=1S/C39H44N3P2.C5H5.Fe/c1-30(36-28-17-29-37(36)43(32-20-9-3-10-21-32)33-22-11-4-12-23-33)42-39(38(40-41-42)31-18-7-2-8-19-31)44(34-24-13-5-14-25-34)35-26-15-6-16-27-35;1-2-4-5-3-1;/h2-4,7-12,17-23,28-30,34-35H,5-6,13-16,24-27H2,1H3;1-5H;/q2*-1;+2/t30-;;/m0../s1 |
| InChIKey | VQSIREKZRXPPRN-ARIINYJRSA-N |
| XLogP | 10.21 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 737.69 |
| LogP ≤ 5 | 10.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|