C44H44NO5+ — CID 139251874
bis[(4-ethynylphenyl)methyl]azanium;2,9,15,18,21-pentaoxatetracyclo[21.2.2.24,7.210,13]hentriaconta-1(26),4,6,10,12,23(27),24,28,30-nonaene (PubChem CID 139251874) has the molecular formula C44H44NO5+ and a molecular weight of 666.84 g/mol. Its IUPAC name is bis[(4-ethynylphenyl)methyl]azanium;2,9,15,18,21-pentaoxatetracyclo[21.2.2.24,7.210,13]hentriaconta-1(26),4,6,10,12,23(27),24,28,30-nonaene.
| Compound Name | bis[(4-ethynylphenyl)methyl]azanium;2,9,15,18,21-pentaoxatetracyclo[21.2.2.24,7.210,13]hentriaconta-1(26),4,6,10,12,23(27),24,28,30-nonaene |
|---|---|
| PubChem CID | 139251874 |
| Molecular Formula | C44H44NO5+ |
| Molecular Weight | 666.84 g/mol |
| Exact Mass | 666.32 |
| IUPAC Name | bis[(4-ethynylphenyl)methyl]azanium;2,9,15,18,21-pentaoxatetracyclo[21.2.2.24,7.210,13]hentriaconta-1(26),4,6,10,12,23(27),24,28,30-nonaene |
| SMILES | C#Cc1ccc(C[NH2+]Cc2ccc(C#C)cc2)cc1.c1cc2ccc1COCCOCCOCc1ccc(cc1)OCc1ccc(cc1)CO2 |
| InChI | InChI=1S/C26H28O5.C18H15N/c1-2-24-4-3-23(1)19-30-25-9-5-21(6-10-25)17-28-15-13-27-14-16-29-18-22-7-11-26(12-8-22)31-20-24;1-3-15-5-9-17(10-6-15)13-19-14-18-11-7-16(4-2)8-12-18/h1-12H,13-20H2;1-2,5-12,19H,13-14H2/p+1 |
| InChIKey | OKWZQNLQEPGSGM-UHFFFAOYSA-O |
| XLogP | 6.82 |
| TPSA | 62.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.84 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|