C43H54NO9+ — CID 139251880
(3,5-dimethylphenyl)methyl-[(4-prop-2-ynoxyphenyl)methyl]azanium;2,5,8,11,18,21,24,27-octaoxatricyclo[26.4.0.012,17]dotriaconta-1(32),12,14,16,28,30-hexaene (PubChem CID 139251880) has the molecular formula C43H54NO9+ and a molecular weight of 728.90 g/mol. Its IUPAC name is (3,5-dimethylphenyl)methyl-[(4-prop-2-ynoxyphenyl)methyl]azanium;2,5,8,11,18,21,24,27-octaoxatricyclo[26.4.0.012,17]dotriaconta-1(32),12,14,16,28,30-hexaene.
| Compound Name | (3,5-dimethylphenyl)methyl-[(4-prop-2-ynoxyphenyl)methyl]azanium;2,5,8,11,18,21,24,27-octaoxatricyclo[26.4.0.012,17]dotriaconta-1(32),12,14,16,28,30-hexaene |
|---|---|
| PubChem CID | 139251880 |
| Molecular Formula | C43H54NO9+ |
| Molecular Weight | 728.90 g/mol |
| Exact Mass | 728.38 |
| IUPAC Name | (3,5-dimethylphenyl)methyl-[(4-prop-2-ynoxyphenyl)methyl]azanium;2,5,8,11,18,21,24,27-octaoxatricyclo[26.4.0.012,17]dotriaconta-1(32),12,14,16,28,30-hexaene |
| SMILES | C#CCOc1ccc(C[NH2+]Cc2cc(C)cc(C)c2)cc1.c1ccc2c(c1)OCCOCCOCCOc1ccccc1OCCOCCOCCO2 |
| InChI | InChI=1S/C24H32O8.C19H21NO/c1-2-6-22-21(5-1)29-17-13-25-9-10-27-15-19-31-23-7-3-4-8-24(23)32-20-16-28-12-11-26-14-18-30-22;1-4-9-21-19-7-5-17(6-8-19)13-20-14-18-11-15(2)10-16(3)12-18/h1-8H,9-20H2;1,5-8,10-12,20H,9,13-14H2,2-3H3/p+1 |
| InChIKey | CZALNMTWCCBHNB-UHFFFAOYSA-O |
| XLogP | 5.56 |
| TPSA | 99.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 728.90 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|