C17H36O5Si — CID 139252190
(3S,4S)-7-[tert-butyl(dimethyl)silyl]oxy-4-(2-methoxyethoxymethoxy)hept-1-en-3-ol (PubChem CID 139252190) has the molecular formula C17H36O5Si and a molecular weight of 348.56 g/mol. Its IUPAC name is (3S,4S)-7-[tert-butyl(dimethyl)silyl]oxy-4-(2-methoxyethoxymethoxy)hept-1-en-3-ol.
| Compound Name | (3S,4S)-7-[tert-butyl(dimethyl)silyl]oxy-4-(2-methoxyethoxymethoxy)hept-1-en-3-ol |
|---|---|
| PubChem CID | 139252190 |
| Molecular Formula | C17H36O5Si |
| Molecular Weight | 348.56 g/mol |
| Exact Mass | 348.23 |
| IUPAC Name | (3S,4S)-7-[tert-butyl(dimethyl)silyl]oxy-4-(2-methoxyethoxymethoxy)hept-1-en-3-ol |
| SMILES | C=C[C@H](O)[C@H](CCCO[Si](C)(C)C(C)(C)C)OCOCCOC |
| InChI | InChI=1S/C17H36O5Si/c1-8-15(18)16(21-14-20-13-12-19-5)10-9-11-22-23(6,7)17(2,3)4/h8,15-16,18H,1,9-14H2,2-7H3/t15-,16-/m0/s1 |
| InChIKey | PUPLBXXEHLAJLF-HOTGVXAUSA-N |
| XLogP | 3.34 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.56 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|