C22H46Si2 — CID 139252467
[(Z,3Z)-2-hexyl-3-(trimethylsilylmethylidene)non-1-enyl]-trimethylsilane (PubChem CID 139252467) has the molecular formula C22H46Si2 and a molecular weight of 366.78 g/mol. Its IUPAC name is [(Z,3Z)-2-hexyl-3-(trimethylsilylmethylidene)non-1-enyl]-trimethylsilane.
| Compound Name | [(Z,3Z)-2-hexyl-3-(trimethylsilylmethylidene)non-1-enyl]-trimethylsilane |
|---|---|
| PubChem CID | 139252467 |
| Molecular Formula | C22H46Si2 |
| Molecular Weight | 366.78 g/mol |
| Exact Mass | 366.31 |
| IUPAC Name | [(Z,3Z)-2-hexyl-3-(trimethylsilylmethylidene)non-1-enyl]-trimethylsilane |
| SMILES | CCCCCCC(=C/[Si](C)(C)C)/C(=C\[Si](C)(C)C)CCCCCC |
| InChI | InChI=1S/C22H46Si2/c1-9-11-13-15-17-21(19-23(3,4)5)22(20-24(6,7)8)18-16-14-12-10-2/h19-20H,9-18H2,1-8H3/b21-19-,22-20- |
| InChIKey | DQFSFWFAYJLDLR-WRBBJXAJSA-N |
| XLogP | 8.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.78 |
| LogP ≤ 5 | 8.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|