C20H36O2Si — CID 139252510
(2E,4Z,6S,8Z,11Z)-1-[tert-butyl(dimethyl)silyl]oxytetradeca-2,4,8,11-tetraen-6-ol (PubChem CID 139252510) has the molecular formula C20H36O2Si and a molecular weight of 336.59 g/mol. Its IUPAC name is (2E,4Z,6S,8Z,11Z)-1-[tert-butyl(dimethyl)silyl]oxytetradeca-2,4,8,11-tetraen-6-ol.
| Compound Name | (2E,4Z,6S,8Z,11Z)-1-[tert-butyl(dimethyl)silyl]oxytetradeca-2,4,8,11-tetraen-6-ol |
|---|---|
| PubChem CID | 139252510 |
| Molecular Formula | C20H36O2Si |
| Molecular Weight | 336.59 g/mol |
| Exact Mass | 336.25 |
| IUPAC Name | (2E,4Z,6S,8Z,11Z)-1-[tert-butyl(dimethyl)silyl]oxytetradeca-2,4,8,11-tetraen-6-ol |
| SMILES | CC/C=C\C/C=C\C[C@H](O)/C=C\C=C\CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H36O2Si/c1-7-8-9-10-11-13-16-19(21)17-14-12-15-18-22-23(5,6)20(2,3)4/h8-9,11-15,17,19,21H,7,10,16,18H2,1-6H3/b9-8-,13-11-,15-12+,17-14-/t19-/m0/s1 |
| InChIKey | XLZNQHMWNZWNHG-KDOQMJLOSA-N |
| XLogP | 5.78 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.59 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|