C26H50O2Si2 — CID 139252511
tert-butyl-[(2E,4Z,6S,8Z,11Z)-6-[tert-butyl(dimethyl)silyl]oxytetradeca-2,4,8,11-tetraenoxy]-dimethylsilane (PubChem CID 139252511) has the molecular formula C26H50O2Si2 and a molecular weight of 450.86 g/mol. Its IUPAC name is tert-butyl-[(2E,4Z,6S,8Z,11Z)-6-[tert-butyl(dimethyl)silyl]oxytetradeca-2,4,8,11-tetraenoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(2E,4Z,6S,8Z,11Z)-6-[tert-butyl(dimethyl)silyl]oxytetradeca-2,4,8,11-tetraenoxy]-dimethylsilane |
|---|---|
| PubChem CID | 139252511 |
| Molecular Formula | C26H50O2Si2 |
| Molecular Weight | 450.86 g/mol |
| Exact Mass | 450.33 |
| IUPAC Name | tert-butyl-[(2E,4Z,6S,8Z,11Z)-6-[tert-butyl(dimethyl)silyl]oxytetradeca-2,4,8,11-tetraenoxy]-dimethylsilane |
| SMILES | CC/C=C\C/C=C\C[C@@H](/C=C\C=C\CO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C26H50O2Si2/c1-12-13-14-15-16-18-21-24(28-30(10,11)26(5,6)7)22-19-17-20-23-27-29(8,9)25(2,3)4/h13-14,16-20,22,24H,12,15,21,23H2,1-11H3/b14-13-,18-16-,20-17+,22-19-/t24-/m0/s1 |
| InChIKey | YCAAOPGLWKMMFA-WZXAEZPCSA-N |
| XLogP | 8.81 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.86 |
| LogP ≤ 5 | 8.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|