C14H22O5 — CID 139252621
dimethyl (4R)-3-methylidene-4-[(2R)-1,1,1-trideuterio-2-methoxypropan-2-yl]cyclopentane-1,1-dicarboxylate (PubChem CID 139252621) has the molecular formula C14H22O5 and a molecular weight of 273.34 g/mol. Its IUPAC name is dimethyl (4R)-3-methylidene-4-[(2R)-1,1,1-trideuterio-2-methoxypropan-2-yl]cyclopentane-1,1-dicarboxylate.
| Compound Name | dimethyl (4R)-3-methylidene-4-[(2R)-1,1,1-trideuterio-2-methoxypropan-2-yl]cyclopentane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 139252621 |
| Molecular Formula | C14H22O5 |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.17 |
| IUPAC Name | dimethyl (4R)-3-methylidene-4-[(2R)-1,1,1-trideuterio-2-methoxypropan-2-yl]cyclopentane-1,1-dicarboxylate |
| SMILES | [2H]C([2H])([2H])[C@@](C)(OC)[C@@H]1CC(C(=O)OC)(C(=O)OC)CC1=C |
| InChI | InChI=1S/C14H22O5/c1-9-7-14(11(15)17-4,12(16)18-5)8-10(9)13(2,3)19-6/h10H,1,7-8H2,2-6H3/t10-/m1/s1/i2D3/t10-,13+ |
| InChIKey | JWNQBRXEALGAFU-VSYBQIOESA-N |
| XLogP | 1.71 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|