About (E)-1-nitroundec-1-ene
(E)-1-nitroundec-1-ene (PubChem CID 139252684) has the molecular formula C11H21NO2
and a molecular weight of 199.29 g/mol. Its IUPAC name is (E)-1-nitroundec-1-ene.
Molecular Properties
| Compound Name | (E)-1-nitroundec-1-ene |
| PubChem CID | 139252684 |
| Molecular Formula | C11H21NO2 |
| Molecular Weight | 199.29 g/mol |
| Exact Mass | 199.16 |
| IUPAC Name | (E)-1-nitroundec-1-ene |
| SMILES | CCCCCCCCC/C=C/[N+](=O)[O-] |
| InChI | InChI=1S/C11H21NO2/c1-2-3-4-5-6-7-8-9-10-11-12(13)14/h10-11H,2-9H2,1H3/b11-10+ |
| InChIKey | CVAAUZOIEFLZEK-ZHACJKMWSA-N |
| XLogP | 3.92 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.29 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (E)-1-nitroundec-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-1-nitroundec-1-ene?
The IUPAC name of (E)-1-nitroundec-1-ene (CID 139252684) is (E)-1-nitroundec-1-ene.
What is the SMILES notation for (E)-1-nitroundec-1-ene?
The canonical SMILES for (E)-1-nitroundec-1-ene is CCCCCCCCC/C=C/[N+](=O)[O-].
What is the InChIKey of (E)-1-nitroundec-1-ene?
The InChIKey is CVAAUZOIEFLZEK-ZHACJKMWSA-N. The full InChI is InChI=1S/C11H21NO2/c1-2-3-4-5-6-7-8-9-10-11-12(13)14/h10-11H,2-9H2,1H3/b11-10+.
What are the key properties of (E)-1-nitroundec-1-ene?
(E)-1-nitroundec-1-ene has a molecular weight of 199.29 g/mol, XLogP of 3.92, 9 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-1-nitroundec-1-ene is sourced from PubChem (CID 139252684), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).