C28H52Sn — CID 139252761
tributyl-(3,4,6,7,8-pentamethyl-5-methylidenedec-9-en-1-ynyl)stannane (PubChem CID 139252761) has the molecular formula C28H52Sn and a molecular weight of 507.44 g/mol. Its IUPAC name is tributyl-(3,4,6,7,8-pentamethyl-5-methylidenedec-9-en-1-ynyl)stannane.
| Compound Name | tributyl-(3,4,6,7,8-pentamethyl-5-methylidenedec-9-en-1-ynyl)stannane |
|---|---|
| PubChem CID | 139252761 |
| Molecular Formula | C28H52Sn |
| Molecular Weight | 507.44 g/mol |
| Exact Mass | 508.31 |
| IUPAC Name | tributyl-(3,4,6,7,8-pentamethyl-5-methylidenedec-9-en-1-ynyl)stannane |
| SMILES | C=CC(C)C(C)C(C)C(=C)C(C)C(C)C#C[Sn](CCCC)(CCCC)CCCC |
| InChI | InChI=1S/C16H25.3C4H9.Sn/c1-9-11(3)13(5)15(7)16(8)14(6)12(4)10-2;3*1-3-4-2;/h9,11-15H,1,8H2,3-7H3;3*1,3-4H2,2H3; |
| InChIKey | VPDUTJLUXVFUEW-UHFFFAOYSA-N |
| XLogP | 9.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.44 |
| LogP ≤ 5 | 9.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|